Products 2820190-60-9
CAS 2820190-60-9 is the registry number for Ethyl 6-bromo-4H-thieno[3,2-b]pyrrole-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 6-bromo-4H-thieno[3,2-b]pyrrole-2-carboxylate (CAS 2820190-60-9) is a chemical compound with the molecular formula C9H8BrNO2S and a molecular weight of 274.14 g/mol. IUPAC name: ethyl 6-bromo-4H-thieno[3,2-b]pyrrole-2-carboxylate. InChIKey: OKCLSEFUBIYKJA-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2S |
|---|---|
| Molecular weight | 274.14 g/mol |
| IUPAC name | ethyl 6-bromo-4H-thieno[3,2-b]pyrrole-2-carboxylate |
| InChIKey | OKCLSEFUBIYKJA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)C(=CN2)Br |
Computed by PubChem (NCBI)