CAS 864169-36-8 appears in our catalog under these names: 2-Bromo-5,6-dimethoxybenzo(d)thiazole, 97%, 2-Bromo-5,6-dimethoxy-1,3-benzothiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 0,5g, 50mg.
2-bromo-5,6-dimethoxy-1,3-benzothiazole (CAS 864169-36-8) is a chemical compound with the molecular formula C9H8BrNO2S and a molecular weight of 274.14 g/mol. IUPAC name: 2-bromo-5,6-dimethoxy-1,3-benzothiazole. InChIKey: MTGQYPIUTNSWAD-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2S |
|---|---|
| Molecular weight | 274.14 g/mol |
| IUPAC name | 2-bromo-5,6-dimethoxy-1,3-benzothiazole |
| InChIKey | MTGQYPIUTNSWAD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=C(S2)Br)OC |
Computed by PubChem (NCBI)