CAS 282107-30-6 is the registry number for (Methyl)triphenylphosphonium Iodide-d3,13CD3. Offered by: TRC. Available pack sizes: 250mg, 25mg.
Triphenyl(trideuterio(113C)methyl)phosphanium iodide (CAS 282107-30-6) is a chemical compound with the molecular formula C19H18IP and a molecular weight of 408.2 g/mol. IUPAC name: triphenyl(trideuterio(113C)methyl)phosphanium iodide. InChIKey: JNMIXMFEVJHFNY-SPZGMPHYSA-M.
| Molecular formula | C19H18IP |
|---|---|
| Molecular weight | 408.2 g/mol |
| IUPAC name | triphenyl(trideuterio(113C)methyl)phosphanium iodide |
| InChIKey | JNMIXMFEVJHFNY-SPZGMPHYSA-M |
| SMILES | [2H][13C]([2H])([2H])[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[I-] |
Computed by PubChem (NCBI)