CAS 81826-67-7 is the registry number for Methyl)triphenylphosphonium Iodide-13C. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
(113C)methyl(triphenyl)phosphanium iodide (CAS 81826-67-7) is a chemical compound with the molecular formula C19H18IP and a molecular weight of 405.2 g/mol. IUPAC name: (113C)methyl(triphenyl)phosphanium iodide. InChIKey: JNMIXMFEVJHFNY-YTBWXGASSA-M.
| Molecular formula | C19H18IP |
|---|---|
| Molecular weight | 405.2 g/mol |
| IUPAC name | (113C)methyl(triphenyl)phosphanium iodide |
| InChIKey | JNMIXMFEVJHFNY-YTBWXGASSA-M |
| SMILES | [13CH3][P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[I-] |
Computed by PubChem (NCBI)