Products 28233-34-3
CAS 28233-34-3 appears in our catalog under these names: N–Methylatalaphylline, N-Methylatalaphylline. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
1,3,5-trihydroxy-10-methyl-2,4-bis(3-methylbut-2-enyl)acridin-9-one (CAS 28233-34-3) is a chemical compound with the molecular formula C24H27NO4 and a molecular weight of 393.5 g/mol. IUPAC name: 1,3,5-trihydroxy-10-methyl-2,4-bis(3-methylbut-2-enyl)acridin-9-one. InChIKey: ISJBDHUGVDBULE-UHFFFAOYSA-N.
| Molecular formula | C24H27NO4 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | 1,3,5-trihydroxy-10-methyl-2,4-bis(3-methylbut-2-enyl)acridin-9-one |
| InChIKey | ISJBDHUGVDBULE-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=C(C(=C1O)CC=C(C)C)O)C(=O)C3=C(N2C)C(=CC=C3)O)C |
Computed by PubChem (NCBI)