CAS 2824130-84-7 is the registry number for (Indolin-4-ylimino)dimethyl-l6-sulfanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dihydro-1H-indol-4-ylimino-dimethyl-oxo-lambda6-sulfane (CAS 2824130-84-7) is a chemical compound with the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. IUPAC name: 2,3-dihydro-1H-indol-4-ylimino-dimethyl-oxo-lambda6-sulfane. InChIKey: RQVWFHWKIRMLOK-UHFFFAOYSA-N.
| Molecular formula | C10H14N2OS |
|---|---|
| Molecular weight | 210.30 g/mol |
| IUPAC name | 2,3-dihydro-1H-indol-4-ylimino-dimethyl-oxo-lambda6-sulfane |
| InChIKey | RQVWFHWKIRMLOK-UHFFFAOYSA-N |
| SMILES | CS(=NC1=CC=CC2=C1CCN2)(=O)C |
Computed by PubChem (NCBI)