Products 2824189-00-4
CAS 2824189-00-4 is the registry number for tert-Butyl (2R,4S)-2-methyl-4-(((methylsulfonyl)oxy)methyl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,4S)-2-methyl-4-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate (CAS 2824189-00-4) is a chemical compound with the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. IUPAC name: tert-butyl (2R,4S)-2-methyl-4-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate. InChIKey: XWJICUUGLAXYRC-ZJUUUORDSA-N.
| Molecular formula | C12H23NO5S |
|---|---|
| Molecular weight | 293.38 g/mol |
| IUPAC name | tert-butyl (2R,4S)-2-methyl-4-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | XWJICUUGLAXYRC-ZJUUUORDSA-N |
| SMILES | C[C@@H]1C[C@@H](CN1C(=O)OC(C)(C)C)COS(=O)(=O)C |
Computed by PubChem (NCBI)