CAS 2172061-46-8 is the registry number for tert-Butyl 2-((methanesulfonyloxy)methyl)-3,3-dimethylazetidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 3,3-dimethyl-2-(methylsulfonyloxymethyl)azetidine-1-carboxylate (CAS 2172061-46-8) is a chemical compound with the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. IUPAC name: tert-butyl 3,3-dimethyl-2-(methylsulfonyloxymethyl)azetidine-1-carboxylate. InChIKey: FDLXHNACSTVXIA-UHFFFAOYSA-N.
| Molecular formula | C12H23NO5S |
|---|---|
| Molecular weight | 293.38 g/mol |
| IUPAC name | tert-butyl 3,3-dimethyl-2-(methylsulfonyloxymethyl)azetidine-1-carboxylate |
| InChIKey | FDLXHNACSTVXIA-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1COS(=O)(=O)C)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)