CAS 364356-44-5 is the registry number for (S)-(((Methylsulfonyl)oxy)methyl)piperidine-1-carboxylic Acid tert-Butyl Ester. Offered by: TRC. Available pack sizes: 750mg.
Tert-butyl (3S)-3-(methylsulfonyloxymethyl)piperidine-1-carboxylate (CAS 364356-44-5) is a chemical compound with the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. IUPAC name: tert-butyl (3S)-3-(methylsulfonyloxymethyl)piperidine-1-carboxylate. InChIKey: NEZJCDLNARUJSX-JTQLQIEISA-N.
| Molecular formula | C12H23NO5S |
|---|---|
| Molecular weight | 293.38 g/mol |
| IUPAC name | tert-butyl (3S)-3-(methylsulfonyloxymethyl)piperidine-1-carboxylate |
| InChIKey | NEZJCDLNARUJSX-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)COS(=O)(=O)C |
Computed by PubChem (NCBI)