CAS 28242-68-4 is the registry number for N-(5-tert-Butyl-1,3,4-thiadiazol-2-yl)-2-chloroacetamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-chloroacetamide (CAS 28242-68-4) is a chemical compound with the molecular formula C8H12ClN3OS and a molecular weight of 233.72 g/mol. IUPAC name: N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-chloroacetamide. InChIKey: QGFUIOYVGOURCJ-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN3OS |
|---|---|
| Molecular weight | 233.72 g/mol |
| IUPAC name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-chloroacetamide |
| InChIKey | QGFUIOYVGOURCJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN=C(S1)NC(=O)CCl |
Computed by PubChem (NCBI)