CAS 28250-14-8 appears in our catalog under these names: Ethyl trans-2-amino-1-cyclohexanecarboxylate hydrochloride, 98%, trans-Ethyl 2-aminocyclohexanecarboxylate hydrochloride, 95%, 95%. Offered by: Thermo Scientific (Acros), Chemat. Available pack sizes: 1g, 100mg, 250mg.
Trans-ethyl (1R,2R)-2-aminocyclohexane-1-carboxylate;hydrochloride (CAS 28250-14-8) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: trans-ethyl (1R,2R)-2-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: XMQSOBPCWYVZSW-SCLLHFNJSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | trans-ethyl (1R,2R)-2-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | XMQSOBPCWYVZSW-SCLLHFNJSA-N |
| SMILES | CCOC(=O)[C@@H]1CCCC[C@H]1N.Cl |
Computed by PubChem (NCBI)