Products 2826264-81-5
CAS 2826264-81-5 is the registry number for Pulixin. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-amino-7,9-dihydroxy-1-methylbenzo[c]chromen-6-one (CAS 2826264-81-5) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 3-amino-7,9-dihydroxy-1-methylbenzo[c]chromen-6-one. InChIKey: KAASRWALAPIHNZ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 3-amino-7,9-dihydroxy-1-methylbenzo[c]chromen-6-one |
| InChIKey | KAASRWALAPIHNZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1C3=C(C(=CC(=C3)O)O)C(=O)O2)N |
Computed by PubChem (NCBI)