CAS 458537-98-9 is the registry number for Methyl 3-nitro-5-phenylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-nitro-5-phenylbenzoate (CAS 458537-98-9) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: methyl 3-nitro-5-phenylbenzoate. InChIKey: FZUCZSWJAUYLMI-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | methyl 3-nitro-5-phenylbenzoate |
| InChIKey | FZUCZSWJAUYLMI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C2=CC=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)