Products 2828433-66-3
CAS 2828433-66-3 is the registry number for tert-Butyl 2-((3,5,6-trimethylpyrazin-2-yl)methyl)hydrazine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[(3,5,6-trimethylpyrazin-2-yl)methylamino]carbamate (CAS 2828433-66-3) is a chemical compound with the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. IUPAC name: tert-butyl N-[(3,5,6-trimethylpyrazin-2-yl)methylamino]carbamate. InChIKey: WLXUNGWFWAZEJS-UHFFFAOYSA-N.
| Molecular formula | C13H22N4O2 |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | tert-butyl N-[(3,5,6-trimethylpyrazin-2-yl)methylamino]carbamate |
| InChIKey | WLXUNGWFWAZEJS-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C(=N1)C)CNNC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)