CAS 2828433-78-7 appears in our catalog under these names: 3-Bromo-4-fluorophthalic acid, 98%, 98%, 3-Bromo-4-fluorophthalic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
3-bromo-4-fluorophthalic acid (CAS 2828433-78-7) is a chemical compound with the molecular formula C8H4BrFO4 and a molecular weight of 263.02 g/mol. IUPAC name: 3-bromo-4-fluorophthalic acid. InChIKey: QSNFQBDOMPTCOH-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFO4 |
|---|---|
| Molecular weight | 263.02 g/mol |
| IUPAC name | 3-bromo-4-fluorophthalic acid |
| InChIKey | QSNFQBDOMPTCOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)C(=O)O)Br)F |
Computed by PubChem (NCBI)