CAS 344309-11-1 appears in our catalog under these names: 5–bromo–3–fluorophthalic acid, 5-Bromo-3-fluorophthalic acid 98%, 5-bromo-3-fluorophthalic acid, 98%, 98%, 5-BROMO-3-FLUOROPHTHALIC ACID, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 500mg, 100mg, 250mg, 5g.
5-bromo-3-fluorophthalic acid (CAS 344309-11-1) is a chemical compound with the molecular formula C8H4BrFO4 and a molecular weight of 263.02 g/mol. IUPAC name: 5-bromo-3-fluorophthalic acid. InChIKey: CQESHYBJGNERMN-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFO4 |
|---|---|
| Molecular weight | 263.02 g/mol |
| IUPAC name | 5-bromo-3-fluorophthalic acid |
| InChIKey | CQESHYBJGNERMN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)C(=O)O)F)Br |
Computed by PubChem (NCBI)