Products 2828438-54-4
CAS 2828438-54-4 appears in our catalog under these names: (S)-2-(6-Cyclopropylpyridin-2-yl)-4-isopropyl-4,5-dihydrooxazole, 97%, 97%, (S)-2-(6-Cyclopropylpyridin-2-yl)-4-isopropyl-4,5-dihydrooxazole, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4S)-2-(6-cyclopropyl-2-pyridinyl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole (CAS 2828438-54-4) is a chemical compound with the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. IUPAC name: (4S)-2-(6-cyclopropyl-2-pyridinyl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole. InChIKey: HJJVVAHSZBLOFY-CYBMUJFWSA-N.
| Molecular formula | C14H18N2O |
|---|---|
| Molecular weight | 230.31 g/mol |
| IUPAC name | (4S)-2-(6-cyclopropyl-2-pyridinyl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | HJJVVAHSZBLOFY-CYBMUJFWSA-N |
| SMILES | CC(C)[C@H]1COC(=N1)C2=CC=CC(=N2)C3CC3 |
Computed by PubChem (NCBI)