Products 2828438-71-5
CAS 2828438-71-5 is the registry number for (S)-2-(6-Cyclopropylpyridin-2-yl)-4-ethyl-4,5-dihydrooxazole, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
(4S)-2-(6-cyclopropyl-2-pyridinyl)-4-ethyl-4,5-dihydro-1,3-oxazole (CAS 2828438-71-5) is a chemical compound with the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. IUPAC name: (4S)-2-(6-cyclopropyl-2-pyridinyl)-4-ethyl-4,5-dihydro-1,3-oxazole. InChIKey: LTWUGUBERMUQQK-JTQLQIEISA-N.
| Molecular formula | C13H16N2O |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | (4S)-2-(6-cyclopropyl-2-pyridinyl)-4-ethyl-4,5-dihydro-1,3-oxazole |
| InChIKey | LTWUGUBERMUQQK-JTQLQIEISA-N |
| SMILES | CC[C@H]1COC(=N1)C2=CC=CC(=N2)C3CC3 |
Computed by PubChem (NCBI)