Products 2828439-84-3
CAS 2828439-84-3 is the registry number for Methyl 4-(ethylcarbamoyl)cubane-1-carboxylate, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 4-(ethylcarbamoyl)cubane-1-carboxylate (CAS 2828439-84-3) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: methyl 4-(ethylcarbamoyl)cubane-1-carboxylate. InChIKey: SUZNNPQFVWBWQZ-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | methyl 4-(ethylcarbamoyl)cubane-1-carboxylate |
| InChIKey | SUZNNPQFVWBWQZ-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C12C3C4C1C5C2C3C45C(=O)OC |
Computed by PubChem (NCBI)