CAS 2828444-03-5 is the registry number for (3-Chloro-4-fluoro-5-(methoxycarbonyl)phenyl)boronic acid, 95+%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(3-chloro-4-fluoro-5-methoxycarbonylphenyl)boronic acid (CAS 2828444-03-5) is a chemical compound with the molecular formula C8H7BClFO4 and a molecular weight of 232.40 g/mol. IUPAC name: (3-chloro-4-fluoro-5-methoxycarbonylphenyl)boronic acid. InChIKey: XOPYIVVCIARSRE-UHFFFAOYSA-N.
| Molecular formula | C8H7BClFO4 |
|---|---|
| Molecular weight | 232.40 g/mol |
| IUPAC name | (3-chloro-4-fluoro-5-methoxycarbonylphenyl)boronic acid |
| InChIKey | XOPYIVVCIARSRE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)F)C(=O)OC)(O)O |
Computed by PubChem (NCBI)