CAS 957066-03-4 appears in our catalog under these names: 2-Chloro-4-fluoro-5-(methoxycarbonyl)phenylboronic acid, 97%, (2-Chloro-4-fluoro-5-(methoxycarbonyl)phenyl)boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg.
(2-chloro-4-fluoro-5-methoxycarbonylphenyl)boronic acid (CAS 957066-03-4) is a chemical compound with the molecular formula C8H7BClFO4 and a molecular weight of 232.40 g/mol. IUPAC name: (2-chloro-4-fluoro-5-methoxycarbonylphenyl)boronic acid. InChIKey: XAEGZJJQEKHVDK-UHFFFAOYSA-N.
| Molecular formula | C8H7BClFO4 |
|---|---|
| Molecular weight | 232.40 g/mol |
| IUPAC name | (2-chloro-4-fluoro-5-methoxycarbonylphenyl)boronic acid |
| InChIKey | XAEGZJJQEKHVDK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)F)C(=O)OC)(O)O |
Computed by PubChem (NCBI)