Products 2828551-22-8
CAS 2828551-22-8 is the registry number for 3-(1-(Methylsulfonyl)ethyl)-1,2,4-thiadiazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1-methylsulfonylethyl)-1,2,4-thiadiazole-5-carboxylic acid (CAS 2828551-22-8) is a chemical compound with the molecular formula C6H8N2O4S2 and a molecular weight of 236.3 g/mol. IUPAC name: 3-(1-methylsulfonylethyl)-1,2,4-thiadiazole-5-carboxylic acid. InChIKey: NGBSQEUXNGXPHQ-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O4S2 |
|---|---|
| Molecular weight | 236.3 g/mol |
| IUPAC name | 3-(1-methylsulfonylethyl)-1,2,4-thiadiazole-5-carboxylic acid |
| InChIKey | NGBSQEUXNGXPHQ-UHFFFAOYSA-N |
| SMILES | CC(C1=NSC(=N1)C(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)