CAS 62557-03-3 is the registry number for 2-(2-(Methylsulfonamido)thiazol-5-yl)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(methanesulfonamido)-1,3-thiazol-5-yl]acetic acid (CAS 62557-03-3) is a chemical compound with the molecular formula C6H8N2O4S2 and a molecular weight of 236.3 g/mol. IUPAC name: 2-[2-(methanesulfonamido)-1,3-thiazol-5-yl]acetic acid. InChIKey: CSBGYAURWPFTRE-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O4S2 |
|---|---|
| Molecular weight | 236.3 g/mol |
| IUPAC name | 2-[2-(methanesulfonamido)-1,3-thiazol-5-yl]acetic acid |
| InChIKey | CSBGYAURWPFTRE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=NC=C(S1)CC(=O)O |
Computed by PubChem (NCBI)