Products 62557-03-3

CAS 62557-03-3 is the registry number for 2-(2-(Methylsulfonamido)thiazol-5-yl)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[2-(methanesulfonamido)-1,3-thiazol-5-yl]acetic acid (CAS 62557-03-3) is a chemical compound with the molecular formula C6H8N2O4S2 and a molecular weight of 236.3 g/mol. IUPAC name: 2-[2-(methanesulfonamido)-1,3-thiazol-5-yl]acetic acid. InChIKey: CSBGYAURWPFTRE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8N2O4S2
Molecular weight236.3 g/mol
IUPAC name2-[2-(methanesulfonamido)-1,3-thiazol-5-yl]acetic acid
InChIKeyCSBGYAURWPFTRE-UHFFFAOYSA-N
SMILESCS(=O)(=O)NC1=NC=C(S1)CC(=O)O

Computed by PubChem (NCBI)