CAS 2828551-23-9 is the registry number for 3-(2-(Methylsulfonyl)propan-2-yl)-1,2,4-thiadiazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-methylsulfonylpropan-2-yl)-1,2,4-thiadiazole-5-carboxylic acid (CAS 2828551-23-9) is a chemical compound with the molecular formula C7H10N2O4S2 and a molecular weight of 250.3 g/mol. IUPAC name: 3-(2-methylsulfonylpropan-2-yl)-1,2,4-thiadiazole-5-carboxylic acid. InChIKey: ACACVDUKNFZMKO-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O4S2 |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 3-(2-methylsulfonylpropan-2-yl)-1,2,4-thiadiazole-5-carboxylic acid |
| InChIKey | ACACVDUKNFZMKO-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NSC(=N1)C(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)