CAS 84448-03-3 is the registry number for N1-Methylbenzene-1,3-disulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-N-methylbenzene-1,3-disulfonamide (CAS 84448-03-3) is a chemical compound with the molecular formula C7H10N2O4S2 and a molecular weight of 250.3 g/mol. IUPAC name: 3-N-methylbenzene-1,3-disulfonamide. InChIKey: PHSISHRGIRMJQN-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O4S2 |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 3-N-methylbenzene-1,3-disulfonamide |
| InChIKey | PHSISHRGIRMJQN-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC=CC(=C1)S(=O)(=O)N |
Computed by PubChem (NCBI)