CAS 2829167-43-1 is the registry number for tert-butyl (3R)-4,4-difluoro-3-(hydroxymethyl)piperidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (3R)-4,4-difluoro-3-(hydroxymethyl)piperidine-1-carboxylate (CAS 2829167-43-1) is a chemical compound with the molecular formula C11H19F2NO3 and a molecular weight of 251.27 g/mol. IUPAC name: tert-butyl (3R)-4,4-difluoro-3-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: QUZQGMWILDEHEY-MRVPVSSYSA-N.
| Molecular formula | C11H19F2NO3 |
|---|---|
| Molecular weight | 251.27 g/mol |
| IUPAC name | tert-butyl (3R)-4,4-difluoro-3-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | QUZQGMWILDEHEY-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC([C@H](C1)CO)(F)F |
Computed by PubChem (NCBI)