CAS 2829279-56-1 is the registry number for (S)-3-(1-Aminoethyl)phenol hydrochloride, 95+%, 95+%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-[(1S)-1-aminoethyl]phenol;hydrochloride (CAS 2829279-56-1) is a chemical compound with the molecular formula C8H12ClNO and a molecular weight of 173.64 g/mol. IUPAC name: 3-[(1S)-1-aminoethyl]phenol;hydrochloride. InChIKey: INBKHDKLDOGKKN-RGMNGODLSA-N.
| Molecular formula | C8H12ClNO |
|---|---|
| Molecular weight | 173.64 g/mol |
| IUPAC name | 3-[(1S)-1-aminoethyl]phenol;hydrochloride |
| InChIKey | INBKHDKLDOGKKN-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)O)N.Cl |
Computed by PubChem (NCBI)