CAS 856563-08-1 appears in our catalog under these names: (R)–3–(1–Aminoethyl)phenol hydrochloride, (R)-3-(1-Aminoethyl)phenol hydrochloride, 95%, (R)-3-(1-Aminoethyl)phenol hydrochloride, 95%, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3-[(1R)-1-aminoethyl]phenol;hydrochloride (CAS 856563-08-1) is a chemical compound with the molecular formula C8H12ClNO and a molecular weight of 173.64 g/mol. IUPAC name: 3-[(1R)-1-aminoethyl]phenol;hydrochloride. InChIKey: INBKHDKLDOGKKN-FYZOBXCZSA-N.
| Molecular formula | C8H12ClNO |
|---|---|
| Molecular weight | 173.64 g/mol |
| IUPAC name | 3-[(1R)-1-aminoethyl]phenol;hydrochloride |
| InChIKey | INBKHDKLDOGKKN-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)O)N.Cl |
Computed by PubChem (NCBI)