CAS 28298-37-5 is the registry number for 3,4-Dichloro-N,N-dimethylbenzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dichloro-N,N-dimethylbenzenesulfonamide (CAS 28298-37-5) is a chemical compound with the molecular formula C8H9Cl2NO2S and a molecular weight of 254.13 g/mol. IUPAC name: 3,4-dichloro-N,N-dimethylbenzenesulfonamide. InChIKey: DQSRUEAZYCYXQZ-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2S |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | 3,4-dichloro-N,N-dimethylbenzenesulfonamide |
| InChIKey | DQSRUEAZYCYXQZ-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)