CAS 865664-00-2 is the registry number for 2,3-Dichloro-N,N-dimethylbenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dichloro-N,N-dimethylbenzenesulfonamide (CAS 865664-00-2) is a chemical compound with the molecular formula C8H9Cl2NO2S and a molecular weight of 254.13 g/mol. IUPAC name: 2,3-dichloro-N,N-dimethylbenzenesulfonamide. InChIKey: PREHLYLSSSYMEO-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2S |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | 2,3-dichloro-N,N-dimethylbenzenesulfonamide |
| InChIKey | PREHLYLSSSYMEO-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)