Products 2831880-22-7
CAS 2831880-22-7 is the registry number for O4-tert-butyl O2-methyl (2S)-2-methylmorpholine-2,4-dicarboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-O-tert-butyl 2-O-methyl (2S)-2-methylmorpholine-2,4-dicarboxylate (CAS 2831880-22-7) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 4-O-tert-butyl 2-O-methyl (2S)-2-methylmorpholine-2,4-dicarboxylate. InChIKey: VOUBMNNPPWLOHA-LBPRGKRZSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 4-O-tert-butyl 2-O-methyl (2S)-2-methylmorpholine-2,4-dicarboxylate |
| InChIKey | VOUBMNNPPWLOHA-LBPRGKRZSA-N |
| SMILES | C[C@]1(CN(CCO1)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)