CAS 2832230-34-7 appears in our catalog under these names: [(1R)-3-oxocyclopentyl]methyl ethanesulfonate, 97%, 97%, [(1R)-3-oxocyclopentyl]methyl ethanesulfonate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
[(1R)-3-oxocyclopentyl]methyl ethanesulfonate (CAS 2832230-34-7) is a chemical compound with the molecular formula C8H14O4S and a molecular weight of 206.26 g/mol. IUPAC name: [(1R)-3-oxocyclopentyl]methyl ethanesulfonate. InChIKey: IONLUNMNHJXIRN-SSDOTTSWSA-N.
| Molecular formula | C8H14O4S |
|---|---|
| Molecular weight | 206.26 g/mol |
| IUPAC name | [(1R)-3-oxocyclopentyl]methyl ethanesulfonate |
| InChIKey | IONLUNMNHJXIRN-SSDOTTSWSA-N |
| SMILES | CCS(=O)(=O)OC[C@@H]1CCC(=O)C1 |
Computed by PubChem (NCBI)