Products 2832304-65-9
CAS 2832304-65-9 is the registry number for (6R)-4-(TERT-BUTOXYCARBONYL)-7-OXA-4-AZASPIRO[2.5]OCTANE-6-CARBOXYLIC ACID, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(6R)-4-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxa-4-azaspiro[2.5]octane-6-carboxylic acid (CAS 2832304-65-9) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: (6R)-4-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxa-4-azaspiro[2.5]octane-6-carboxylic acid. InChIKey: JTEXOLYOMIHEJA-MRVPVSSYSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | (6R)-4-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxa-4-azaspiro[2.5]octane-6-carboxylic acid |
| InChIKey | JTEXOLYOMIHEJA-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](OCC12CC2)C(=O)O |
Computed by PubChem (NCBI)