Products 2833696-08-3
CAS 2833696-08-3 is the registry number for tert-Butyl (1S,5R)-3,8-diazaspiro[bicyclo[3.2.1]octane-2,1'-cyclopropane]-8-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1S,5R)-spiro[3,8-diazabicyclo[3.2.1]octane-2,1'-cyclopropane]-8-carboxylate (CAS 2833696-08-3) is a chemical compound with the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. IUPAC name: tert-butyl (1S,5R)-spiro[3,8-diazabicyclo[3.2.1]octane-2,1'-cyclopropane]-8-carboxylate. InChIKey: XTNGYZKLMLDULS-ZJUUUORDSA-N.
| Molecular formula | C13H22N2O2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | tert-butyl (1S,5R)-spiro[3,8-diazabicyclo[3.2.1]octane-2,1'-cyclopropane]-8-carboxylate |
| InChIKey | XTNGYZKLMLDULS-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1C3(CC3)NC2 |
Computed by PubChem (NCBI)