CAS 283611-26-7 is the registry number for N-((2-Nitrophenyl)sulfonyl)-L-threonine methyl ester, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,3R)-3-hydroxy-2-[(2-nitrophenyl)sulfonylamino]butanoate (CAS 283611-26-7) is a chemical compound with the molecular formula C11H14N2O7S and a molecular weight of 318.31 g/mol. IUPAC name: methyl (2S,3R)-3-hydroxy-2-[(2-nitrophenyl)sulfonylamino]butanoate. InChIKey: QZCHTOFLMKABBR-XCBNKYQSSA-N.
| Molecular formula | C11H14N2O7S |
|---|---|
| Molecular weight | 318.31 g/mol |
| IUPAC name | methyl (2S,3R)-3-hydroxy-2-[(2-nitrophenyl)sulfonylamino]butanoate |
| InChIKey | QZCHTOFLMKABBR-XCBNKYQSSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC)NS(=O)(=O)C1=CC=CC=C1[N+](=O)[O-])O |
Computed by PubChem (NCBI)