Products 283611-49-4

CAS 283611-49-4 is the registry number for N-((2-Nitrophenyl)sulfonyl)-D-allothreonine methyl ester, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl (2R,3R)-3-hydroxy-2-[(2-nitrophenyl)sulfonylamino]butanoate (CAS 283611-49-4) is a chemical compound with the molecular formula C11H14N2O7S and a molecular weight of 318.31 g/mol. IUPAC name: methyl (2R,3R)-3-hydroxy-2-[(2-nitrophenyl)sulfonylamino]butanoate. InChIKey: QZCHTOFLMKABBR-GMSGAONNSA-N.

Identity
Molecular formulaC11H14N2O7S
Molecular weight318.31 g/mol
IUPAC namemethyl (2R,3R)-3-hydroxy-2-[(2-nitrophenyl)sulfonylamino]butanoate
InChIKeyQZCHTOFLMKABBR-GMSGAONNSA-N
SMILESC[C@H]([C@H](C(=O)OC)NS(=O)(=O)C1=CC=CC=C1[N+](=O)[O-])O

Computed by PubChem (NCBI)