CAS 2838097-88-2 is the registry number for Rel-(1S,3R)-4,4-difluorospiro[2.2]pentan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,5S)-2,2-difluorospiro[2.2]pentan-5-amine;hydrochloride (CAS 2838097-88-2) is a chemical compound with the molecular formula C5H8ClF2N and a molecular weight of 155.57 g/mol. IUPAC name: (3R,5S)-2,2-difluorospiro[2.2]pentan-5-amine;hydrochloride. InChIKey: UDVGDPFBYGYNQA-RFKZQXLXSA-N.
| Molecular formula | C5H8ClF2N |
|---|---|
| Molecular weight | 155.57 g/mol |
| IUPAC name | (3R,5S)-2,2-difluorospiro[2.2]pentan-5-amine;hydrochloride |
| InChIKey | UDVGDPFBYGYNQA-RFKZQXLXSA-N |
| SMILES | C1[C@@H]([C@]12CC2(F)F)N.Cl |
Computed by PubChem (NCBI)