Products 2940941-69-3

CAS 2940941-69-3 is the registry number for 2,2-difluorobicyclo[1.1.1]pentan-1-amine hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

2,2-difluorobicyclo[1.1.1]pentan-1-amine;hydrochloride (CAS 2940941-69-3) is a chemical compound with the molecular formula C5H8ClF2N and a molecular weight of 155.57 g/mol. IUPAC name: 2,2-difluorobicyclo[1.1.1]pentan-1-amine;hydrochloride. InChIKey: LLEDYJNZFDQVDG-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8ClF2N
Molecular weight155.57 g/mol
IUPAC name2,2-difluorobicyclo[1.1.1]pentan-1-amine;hydrochloride
InChIKeyLLEDYJNZFDQVDG-UHFFFAOYSA-N
SMILESC1C2CC1(C2(F)F)N.Cl

Computed by PubChem (NCBI)