Products 2839192-25-3
CAS 2839192-25-3 is the registry number for Anti-infective agent 7. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(1-benzylpiperidin-4-yl)-2-(tert-butylamino)benzo[f][1]benzofuran-4,9-dione (CAS 2839192-25-3) is a chemical compound with the molecular formula C28H30N2O3 and a molecular weight of 442.5 g/mol. IUPAC name: 3-(1-benzylpiperidin-4-yl)-2-(tert-butylamino)benzo[f][1]benzofuran-4,9-dione. InChIKey: MRUCKOUZZOKELR-UHFFFAOYSA-N.
| Molecular formula | C28H30N2O3 |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | 3-(1-benzylpiperidin-4-yl)-2-(tert-butylamino)benzo[f][1]benzofuran-4,9-dione |
| InChIKey | MRUCKOUZZOKELR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=C(C2=C(O1)C(=O)C3=CC=CC=C3C2=O)C4CCN(CC4)CC5=CC=CC=C5 |
Computed by PubChem (NCBI)
Synonyms:
Anti-infective agent 7