Products 509-34-2
CAS 509-34-2 appears in our catalog under these names: Solvent Red 49, Solvent red 49, Rhodamine B base, 97%, Rhodamine B base, 97.00%, RHODAMINE B BASE. Offered by: Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Acros), Chemat, Sigma-Aldrich. Available pack sizes: 100mg, 250g, 50g, 25g, 100g, 10g, 1 g, 5 g.
3',6'-bis(diethylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 509-34-2) is a chemical compound with the molecular formula C28H30N2O3 and a molecular weight of 442.5 g/mol. IUPAC name: 3',6'-bis(diethylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: DZNJMLVCIZGWSC-UHFFFAOYSA-N.
| Molecular formula | C28H30N2O3 |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | 3',6'-bis(diethylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | DZNJMLVCIZGWSC-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)N(CC)CC)C5=CC=CC=C5C(=O)O3 |
Computed by PubChem (NCBI)