CAS 2839409-90-2 is the registry number for tert-Butyl (3aR,6aS)-hexahydro-5H-pyrrolo[3,4-d]isoxazole-5-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3aR,6aS)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,2]oxazole-5-carboxylate (CAS 2839409-90-2) is a chemical compound with the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. IUPAC name: tert-butyl (3aR,6aS)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,2]oxazole-5-carboxylate. InChIKey: BJUIMUOEKSHOMK-JGVFFNPUSA-N.
| Molecular formula | C10H18N2O3 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | tert-butyl (3aR,6aS)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,2]oxazole-5-carboxylate |
| InChIKey | BJUIMUOEKSHOMK-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CNO[C@@H]2C1 |
Computed by PubChem (NCBI)