CAS 28399-17-9 appears in our catalog under these names: alfa-Costic acid, α-Costic acid. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
2-[(2R,4aR,8aR)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]prop-2-enoic acid (CAS 28399-17-9) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: 2-[(2R,4aR,8aR)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]prop-2-enoic acid. InChIKey: UTXMCYDEIZPGME-VNHYZAJKSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | 2-[(2R,4aR,8aR)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]prop-2-enoic acid |
| InChIKey | UTXMCYDEIZPGME-VNHYZAJKSA-N |
| SMILES | CC1=CCC[C@]2([C@H]1C[C@@H](CC2)C(=C)C(=O)O)C |
Computed by PubChem (NCBI)