CAS 284019-34-7 is the registry number for Denibulin. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, Get quote.
Methyl N-[6-[4-[[(2S)-2-aminopropanoyl]amino]phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamate (CAS 284019-34-7) is a chemical compound with the molecular formula C18H19N5O3S and a molecular weight of 385.4 g/mol. IUPAC name: methyl N-[6-[4-[[(2S)-2-aminopropanoyl]amino]phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamate. InChIKey: GAOHLWCIAJNSEE-JTQLQIEISA-N.
| Molecular formula | C18H19N5O3S |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | methyl N-[6-[4-[[(2S)-2-aminopropanoyl]amino]phenyl]sulfanyl-1H-benzimidazol-2-yl]carbamate |
| InChIKey | GAOHLWCIAJNSEE-JTQLQIEISA-N |
| SMILES | C[C@@H](C(=O)NC1=CC=C(C=C1)SC2=CC3=C(C=C2)N=C(N3)NC(=O)OC)N |
Computed by PubChem (NCBI)