CAS 767310-01-0 is the registry number for ZINC4497834. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(3,4-dimethylphenyl)-5-[(4-methylphenyl)sulfonylamino]-2H-triazole-4-carboxamide (CAS 767310-01-0) is a chemical compound with the molecular formula C18H19N5O3S and a molecular weight of 385.4 g/mol. IUPAC name: N-(3,4-dimethylphenyl)-5-[(4-methylphenyl)sulfonylamino]-2H-triazole-4-carboxamide. InChIKey: WITFFIFLNAEJMI-UHFFFAOYSA-N.
| Molecular formula | C18H19N5O3S |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | N-(3,4-dimethylphenyl)-5-[(4-methylphenyl)sulfonylamino]-2H-triazole-4-carboxamide |
| InChIKey | WITFFIFLNAEJMI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=NNN=C2C(=O)NC3=CC(=C(C=C3)C)C |
Computed by PubChem (NCBI)