CAS 284474-81-3 appears in our catalog under these names: Ethyl-D5-Amine Hydrochloride, >95% (HPLC), Ethyl-d5-amine HCl, 99 atom % D, min 98% Chemical Purity, ethyl–D5–amine hydrochloride, ETHYL-D5-AMINE HYDROCHLORIDE, 99 ATOM %&. Offered by: TRC, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 0,5g, 10mg, 250mg, 50mg, 5G.
1,1,2,2,2-pentadeuterioethanamine;hydrochloride (CAS 284474-81-3) is a chemical compound with the molecular formula C2H8ClN and a molecular weight of 86.57 g/mol. IUPAC name: 1,1,2,2,2-pentadeuterioethanamine;hydrochloride. InChIKey: XWBDWHCCBGMXKG-LUIAAVAXSA-N.
| Molecular formula | C2H8ClN |
|---|---|
| Molecular weight | 86.57 g/mol |
| IUPAC name | 1,1,2,2,2-pentadeuterioethanamine;hydrochloride |
| InChIKey | XWBDWHCCBGMXKG-LUIAAVAXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N.Cl |
Computed by PubChem (NCBI)