Products 53170-19-7
CAS 53170-19-7 appears in our catalog under these names: Dimethylamine-d6 Hydrochloride, >95% (HPLC), Dimethyl-d6-amine HCl, 98 atom % D, min 98% Chemical Purity, Dimethylamine–d6 hydrochloride, Dimethyl-d6-amine HCl, DIMETHYL-D6-AMINE HYDROCHLORIDE,. Offered by: TRC, CDN, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 1g, 2,5g, 500mg, 5g, 100mg, 25mg, 50mg, 2g.
1,1,1-trideuterio-N-(trideuteriomethyl)methanamine;hydrochloride (CAS 53170-19-7) is a chemical compound with the molecular formula C2H8ClN and a molecular weight of 87.58 g/mol. IUPAC name: 1,1,1-trideuterio-N-(trideuteriomethyl)methanamine;hydrochloride. InChIKey: IQDGSYLLQPDQDV-TXHXQZCNSA-N.
| Molecular formula | C2H8ClN |
|---|---|
| Molecular weight | 87.58 g/mol |
| IUPAC name | 1,1,1-trideuterio-N-(trideuteriomethyl)methanamine;hydrochloride |
| InChIKey | IQDGSYLLQPDQDV-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])NC([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)
Synonyms:
Di((2H3)methyl)ammonium chloride, Di[(2H3)methyl]ammonium chloride, Dimethylamine-d6 Hydrochloride, Dimethylamine D6 Hydrochloride, Dimethyl-d6-amine HCl, Dimethyl-d6-amine hydrochloride, 1,1,1-trideuterio-N-(trideuteriomethyl)methanamine;hydrochloride, 1,1,1-trideuterio-N-(trideuteriomethyl)methanamine hydrochloride, C2H2ClD6N, Dimethyl-d6 amine hydrochloride