CAS 284487-61-2 appears in our catalog under these names: 2-Picolinic-d4 acid, 2-Picolinic-d4 Acid, >95% (HPLC), 2-Picolinic-d4 Acid, 98 atom % D, min 98% Chemical Purity, Picolinic acid–d4, 2-PICOLINIC-D4 ACID, 98 ATOM % D, 99% C. Offered by: Biosynth, TRC, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 25mg, 2,5mg, 5mg, 0,25g, 0,1g, 1mg, 10mg, 100MG.
3,4,5,6-tetradeuteriopyridine-2-carboxylic acid (CAS 284487-61-2) is a chemical compound with the molecular formula C6H5NO2 and a molecular weight of 127.13 g/mol. IUPAC name: 3,4,5,6-tetradeuteriopyridine-2-carboxylic acid. InChIKey: SIOXPEMLGUPBBT-RHQRLBAQSA-N.
| Molecular formula | C6H5NO2 |
|---|---|
| Molecular weight | 127.13 g/mol |
| IUPAC name | 3,4,5,6-tetradeuteriopyridine-2-carboxylic acid |
| InChIKey | SIOXPEMLGUPBBT-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])C(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)