CAS 284487-65-6 appears in our catalog under these names: 2-Methylpentane-d14, 98 atom % D, min 98% Chemical Purity, 2-METHYLPENTANE-D14, 98 ATOM % D. Offered by: CDN, Sigma-Aldrich. Available pack sizes: 0,5g, 0,25g, 1G.
1,1,1,2,2,3,3,4,5,5,5-undecadeuterio-4-(trideuteriomethyl)pentane (CAS 284487-65-6) is a chemical compound with the molecular formula C6H14 and a molecular weight of 100.26 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,5,5,5-undecadeuterio-4-(trideuteriomethyl)pentane. InChIKey: AFABGHUZZDYHJO-YSWKHMAKSA-N.
| Molecular formula | C6H14 |
|---|---|
| Molecular weight | 100.26 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,5,5,5-undecadeuterio-4-(trideuteriomethyl)pentane |
| InChIKey | AFABGHUZZDYHJO-YSWKHMAKSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)