Products 284488-00-2
CAS 284488-00-2 is the registry number for 2-(2,4-Dichlorophenoxy)-N-(4-methoxyphenyl)propanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-dichlorophenoxy)-N-(4-methoxyphenyl)propanamide (CAS 284488-00-2) is a chemical compound with the molecular formula C16H15Cl2NO3 and a molecular weight of 340.2 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)-N-(4-methoxyphenyl)propanamide. InChIKey: ZQCNWOHZKDJRNV-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2NO3 |
|---|---|
| Molecular weight | 340.2 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)-N-(4-methoxyphenyl)propanamide |
| InChIKey | ZQCNWOHZKDJRNV-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC=C(C=C1)OC)OC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)