CAS 930395-63-4 appears in our catalog under these names: 2-Chloro-n-[5-chloro-2-(4-ethoxyphenoxy)phenyl]acetamide, 95%, 2-Chloro-N-(5-chloro-2-(4-ethoxyphenoxy)phenyl)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]acetamide (CAS 930395-63-4) is a chemical compound with the molecular formula C16H15Cl2NO3 and a molecular weight of 340.2 g/mol. IUPAC name: 2-chloro-N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]acetamide. InChIKey: IEYRQDZDIHXTRL-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2NO3 |
|---|---|
| Molecular weight | 340.2 g/mol |
| IUPAC name | 2-chloro-N-[5-chloro-2-(4-ethoxyphenoxy)phenyl]acetamide |
| InChIKey | IEYRQDZDIHXTRL-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)NC(=O)CCl |
Computed by PubChem (NCBI)